CAS 24243-44-5 is the registry number for 1-(4-Nitrophenyl)-9H-pyrido(3,4-b)indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole (CAS 24243-44-5) is a chemical compound with the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. IUPAC name: 1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole. InChIKey: LOZZGBIIZKNDHV-UHFFFAOYSA-N.
| Molecular formula | C17H11N3O2 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-9H-pyrido[3,4-b]indole |
| InChIKey | LOZZGBIIZKNDHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)