CAS 312591-59-6 is the registry number for 2-Quinolin-8-yl-2,3-dihydrophthalazine-1,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-quinolin-8-yl-2H-phthalazine-1,4-dione (CAS 312591-59-6) is a chemical compound with the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. IUPAC name: 3-quinolin-8-yl-2H-phthalazine-1,4-dione. InChIKey: MYXBMYBGVJKMLV-UHFFFAOYSA-N.
| Molecular formula | C17H11N3O2 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 3-quinolin-8-yl-2H-phthalazine-1,4-dione |
| InChIKey | MYXBMYBGVJKMLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NN(C2=O)C3=CC=CC4=C3N=CC=C4 |
Computed by PubChem (NCBI)