CAS 219959-85-0 is the registry number for 9-(4’-Nitrophenyl)-9H-pyrido(3,4-b)indole. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
9-(4-nitrophenyl)pyrido[3,4-b]indole (CAS 219959-85-0) is a chemical compound with the molecular formula C17H11N3O2 and a molecular weight of 289.29 g/mol. IUPAC name: 9-(4-nitrophenyl)pyrido[3,4-b]indole. InChIKey: XJFIJMUNORMRCD-UHFFFAOYSA-N.
| Molecular formula | C17H11N3O2 |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | 9-(4-nitrophenyl)pyrido[3,4-b]indole |
| InChIKey | XJFIJMUNORMRCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2C4=CC=C(C=C4)[N+](=O)[O-])C=NC=C3 |
Computed by PubChem (NCBI)