Products 1023572-61-3
CAS 1023572-61-3 is the registry number for N-(2H-1,3-benzodioxol-5-yl)-4-chloro-2-nitrobenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(1,3-benzodioxol-5-yl)-4-chloro-2-nitrobenzenesulfonamide (CAS 1023572-61-3) is a chemical compound with the molecular formula C13H9ClN2O6S and a molecular weight of 356.74 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)-4-chloro-2-nitrobenzenesulfonamide. InChIKey: UFVSLXWVQOYMNY-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O6S |
|---|---|
| Molecular weight | 356.74 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)-4-chloro-2-nitrobenzenesulfonamide |
| InChIKey | UFVSLXWVQOYMNY-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NS(=O)(=O)C3=C(C=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)