Products 412940-35-3
CAS 412940-35-3 appears in our catalog under these names: 4-Chloro-3-[[(3-nitrophenyl)amino]sulfonyl]-benzoic acid, CTP inhibitor, CTP inhibitor, 98.00%, CTP inhibitor (Standard), CTP inhibitor, 98%. Offered by: Chemat, GLPBio, MedChemExpress, Ambeed. Available pack sizes: 25mg, 10mg, 5mg, 50mg, 5 mg, 10 mg, 50 mg, 25 mg.
4-chloro-3-[(3-nitrophenyl)sulfamoyl]benzoic acid (CAS 412940-35-3) is a chemical compound with the molecular formula C13H9ClN2O6S and a molecular weight of 356.74 g/mol. IUPAC name: 4-chloro-3-[(3-nitrophenyl)sulfamoyl]benzoic acid. InChIKey: IIJQJWNGBILZCU-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O6S |
|---|---|
| Molecular weight | 356.74 g/mol |
| IUPAC name | 4-chloro-3-[(3-nitrophenyl)sulfamoyl]benzoic acid |
| InChIKey | IIJQJWNGBILZCU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NS(=O)(=O)C2=C(C=CC(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-chloro-3-[(3-nitrophenyl)sulfamoyl]benzoic acid, 4-Chloro-3-((3-nitrophenyl)sulfamoyl)benzoic acid, CTP Inhibitor, CFASB, 4-chloro-3-[[(3-nitrophenyl)amino]sulfonyl]-benzoic acid, 4-Chloro-3-(N-(3-nitrophenyl)sulfamoyl)benzoic acid, ZINC Compound 792949, Oprea1_649848, 4-Chloro-3-(3-nitro-phenylsulfamoyl)-benzoic acid, orb1688740