Products 307336-09-0

CAS 307336-09-0 is the registry number for 2-(2-Chloro-5-nitro-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoic acid (CAS 307336-09-0) is a chemical compound with the molecular formula C13H9ClN2O6S and a molecular weight of 356.74 g/mol. IUPAC name: 2-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: ZAAUOKJIOITHHV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9ClN2O6S
Molecular weight356.74 g/mol
IUPAC name2-[(2-chloro-5-nitrophenyl)sulfonylamino]benzoic acid
InChIKeyZAAUOKJIOITHHV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=C(C=CC(=C2)[N+](=O)[O-])Cl

Computed by PubChem (NCBI)