CAS 68003-38-3 appears in our catalog under these names: 2-(4-Chloro-3-nitro-benzenesulfonylamino)-benzoic acid, 95%, CTPI-2/ 97.91% (existing batch purity), CTPI–2, CTPI-2, >98.0%(HPLC)(T), 2-(4-Chloro-3-nitrobenzenesulfonamido)benzoic acid, 98+%, 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 50mg, 200mg, 10mM (in 1ml dmso).
2-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoic acid (CAS 68003-38-3) is a chemical compound with the molecular formula C13H9ClN2O6S and a molecular weight of 356.74 g/mol. IUPAC name: 2-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: NJTHPOSQGFJTDP-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O6S |
|---|---|
| Molecular weight | 356.74 g/mol |
| IUPAC name | 2-[(4-chloro-3-nitrophenyl)sulfonylamino]benzoic acid |
| InChIKey | NJTHPOSQGFJTDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)