CAS 1099139-86-2 is the registry number for 6-Chloro-2-oxo-2,3-dihydro-1H-indole-5-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide (CAS 1099139-86-2) is a chemical compound with the molecular formula C8H7ClN2O3S and a molecular weight of 246.67 g/mol. IUPAC name: 6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide. InChIKey: JHEBAWUKZGBHBM-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3S |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 6-chloro-2-oxo-1,3-dihydroindole-5-sulfonamide |
| InChIKey | JHEBAWUKZGBHBM-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)