CAS 1423026-68-9 is the registry number for 3-Ethylisoxazolo(5,4-b)pyridine-5-sulfonyl chloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CAS 1423026-68-9) is a chemical compound with the molecular formula C8H7ClN2O3S and a molecular weight of 246.67 g/mol. IUPAC name: 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride. InChIKey: MKTIKWLANFECEW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O3S |
|---|---|
| Molecular weight | 246.67 g/mol |
| IUPAC name | 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| InChIKey | MKTIKWLANFECEW-UHFFFAOYSA-N |
| SMILES | CCC1=NOC2=C1C=C(C=N2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)