Products 1023860-94-7
CAS 1023860-94-7 is the registry number for amino((4-((isopropyl)phenylamino)phenyl)amino)methane-1-thione. Offered by: Biosynth. Available pack sizes: 250mg.
[4-(N-propan-2-ylanilino)phenyl]thiourea (CAS 1023860-94-7) is a chemical compound with the molecular formula C16H19N3S and a molecular weight of 285.4 g/mol. IUPAC name: [4-(N-propan-2-ylanilino)phenyl]thiourea. InChIKey: IIWFDAUEWJIWKZ-UHFFFAOYSA-N.
| Molecular formula | C16H19N3S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | [4-(N-propan-2-ylanilino)phenyl]thiourea |
| InChIKey | IIWFDAUEWJIWKZ-UHFFFAOYSA-N |
| SMILES | CC(C)N(C1=CC=CC=C1)C2=CC=C(C=C2)NC(=S)N |
Computed by PubChem (NCBI)