CAS 1330265-10-5 is the registry number for Isothipendyl-d6. Offered by: TRC, MedChemExpress. Available pack sizes: 25mg, 10 mg, 1 mg.
1-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine (CAS 1330265-10-5) is a chemical compound with the molecular formula C16H19N3S and a molecular weight of 291.4 g/mol. IUPAC name: 1-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine. InChIKey: OQJBSDFFQWMKBQ-XERRXZQWSA-N.
| Molecular formula | C16H19N3S |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | 1-pyrido[3,2-b][1,4]benzothiazin-10-yl-N,N-bis(trideuteriomethyl)propan-2-amine |
| InChIKey | OQJBSDFFQWMKBQ-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(C(C)CN1C2=CC=CC=C2SC3=C1N=CC=C3)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)