CAS 2200453-71-8 is the registry number for tau-0N4R-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[4-(dimethylamino)phenyl]-1-methyl-1-phenylthiourea (CAS 2200453-71-8) is a chemical compound with the molecular formula C16H19N3S and a molecular weight of 285.4 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]-1-methyl-1-phenylthiourea. InChIKey: ARRILTLPWPXSOA-UHFFFAOYSA-N.
| Molecular formula | C16H19N3S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]-1-methyl-1-phenylthiourea |
| InChIKey | ARRILTLPWPXSOA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC(=S)N(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)