CAS 183287-72-1 is the registry number for (S)-Isothipendyl. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-N,N-dimethyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-amine (CAS 183287-72-1) is a chemical compound with the molecular formula C16H19N3S and a molecular weight of 285.4 g/mol. IUPAC name: (2S)-N,N-dimethyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-amine. InChIKey: OQJBSDFFQWMKBQ-LBPRGKRZSA-N.
| Molecular formula | C16H19N3S |
|---|---|
| Molecular weight | 285.4 g/mol |
| IUPAC name | (2S)-N,N-dimethyl-1-pyrido[3,2-b][1,4]benzothiazin-10-ylpropan-2-amine |
| InChIKey | OQJBSDFFQWMKBQ-LBPRGKRZSA-N |
| SMILES | C[C@@H](CN1C2=CC=CC=C2SC3=C1N=CC=C3)N(C)C |
Computed by PubChem (NCBI)