CAS 1023870-85-0 is the registry number for 3-((2-(3,4-dimethoxyphenyl)-1-oxoinden-3-yl)amino)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
3-[[2-(3,4-dimethoxyphenyl)-3-oxoinden-1-yl]amino]benzoic acid (CAS 1023870-85-0) is a chemical compound with the molecular formula C24H19NO5 and a molecular weight of 401.4 g/mol. IUPAC name: 3-[[2-(3,4-dimethoxyphenyl)-3-oxoinden-1-yl]amino]benzoic acid. InChIKey: ZHDZBDGPXJHQAY-UHFFFAOYSA-N.
| Molecular formula | C24H19NO5 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 3-[[2-(3,4-dimethoxyphenyl)-3-oxoinden-1-yl]amino]benzoic acid |
| InChIKey | ZHDZBDGPXJHQAY-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C3=CC=CC=C3C2=O)NC4=CC=CC(=C4)C(=O)O)OC |
Computed by PubChem (NCBI)