Products 959662-26-1
CAS 959662-26-1 is the registry number for 7-Hydroxyneolamellarin A. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-2-hydroxy-2-(4-hydroxyphenyl)ethanone (CAS 959662-26-1) is a chemical compound with the molecular formula C24H19NO5 and a molecular weight of 401.4 g/mol. IUPAC name: 1-[3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-2-hydroxy-2-(4-hydroxyphenyl)ethanone. InChIKey: RYIBSKICTMDCHH-UHFFFAOYSA-N.
| Molecular formula | C24H19NO5 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 1-[3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-2-hydroxy-2-(4-hydroxyphenyl)ethanone |
| InChIKey | RYIBSKICTMDCHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN(C=C2C3=CC=C(C=C3)O)C(=O)C(C4=CC=C(C=C4)O)O)O |
Computed by PubChem (NCBI)