CAS 2243508-43-0 is the registry number for 4-{((9H-Fluoren-9-yl)methoxy)carbonyl}-3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylic acid (CAS 2243508-43-0) is a chemical compound with the molecular formula C24H19NO5 and a molecular weight of 401.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylic acid. InChIKey: SKWDYZNWVDHHNI-UHFFFAOYSA-N.
| Molecular formula | C24H19NO5 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonyl)-2,3-dihydro-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | SKWDYZNWVDHHNI-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)