Products 2347639-60-3

CAS 2347639-60-3 is the registry number for Dimethyl 9-acetyl-1-phenyl-9H-carbazole-3,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate (CAS 2347639-60-3) is a chemical compound with the molecular formula C24H19NO5 and a molecular weight of 401.4 g/mol. IUPAC name: dimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate. InChIKey: KOPMEBOSJXKDKP-UHFFFAOYSA-N.

Identity
Molecular formulaC24H19NO5
Molecular weight401.4 g/mol
IUPAC namedimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate
InChIKeyKOPMEBOSJXKDKP-UHFFFAOYSA-N
SMILESCC(=O)N1C2=CC=CC=C2C3=C1C(=CC(=C3C(=O)OC)C(=O)OC)C4=CC=CC=C4

Computed by PubChem (NCBI)