CAS 2347639-60-3 is the registry number for Dimethyl 9-acetyl-1-phenyl-9H-carbazole-3,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate (CAS 2347639-60-3) is a chemical compound with the molecular formula C24H19NO5 and a molecular weight of 401.4 g/mol. IUPAC name: dimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate. InChIKey: KOPMEBOSJXKDKP-UHFFFAOYSA-N.
| Molecular formula | C24H19NO5 |
|---|---|
| Molecular weight | 401.4 g/mol |
| IUPAC name | dimethyl 9-acetyl-1-phenylcarbazole-3,4-dicarboxylate |
| InChIKey | KOPMEBOSJXKDKP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2C3=C1C(=CC(=C3C(=O)OC)C(=O)OC)C4=CC=CC=C4 |
Computed by PubChem (NCBI)