CAS 102389-89-9 appears in our catalog under these names: cis–dimethyl pyrrolidine–3,4–dicarboxylate hydrochloride, cis-Dimethyl pyrrolidine-3,4-dicarboxylate. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g.
Dimethyl (3R,4S)-pyrrolidine-3,4-dicarboxylate (CAS 102389-89-9) is a chemical compound with the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. IUPAC name: dimethyl (3R,4S)-pyrrolidine-3,4-dicarboxylate. InChIKey: DEONENFBMPLKOR-OLQVQODUSA-N.
| Molecular formula | C8H13NO4 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | dimethyl (3R,4S)-pyrrolidine-3,4-dicarboxylate |
| InChIKey | DEONENFBMPLKOR-OLQVQODUSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)