CAS 102390-36-3 appears in our catalog under these names: (1R,4R)-4-(dibenzylamino)cyclohexane-1-carboxylic acid, 97%, (1R,4R)-4-(dibenzylamino)cyclohexane-1-carboxylic acid, 98%, 98%, trans-4-[Bis(phenylmethyl)amino]cyclohexanecarboxylic acid, 99.94%, trans-4-[Bis(phenylmethyl)amino]cyclohexanecarboxylic acid (Standard), trans-4-[Bis(phenylmethyl)amino]cyclohexanecarboxylic acid, 98%. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 250 mg, 100 mg, 1 g, 500 mg.
4-(dibenzylamino)cyclohexane-1-carboxylic acid (CAS 102390-36-3) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: 4-(dibenzylamino)cyclohexane-1-carboxylic acid. InChIKey: BQCQUSWZXHRQBW-UHFFFAOYSA-N.
| Molecular formula | C21H25NO2 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 4-(dibenzylamino)cyclohexane-1-carboxylic acid |
| InChIKey | BQCQUSWZXHRQBW-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C(=O)O)N(CC2=CC=CC=C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)