Products 874990-36-0

CAS 874990-36-0 is the registry number for ethyl (trans)–1–benzyl–4–(m–tolyl)pyrrolidine–3–carboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 1-benzyl-4-(3-methylphenyl)pyrrolidine-3-carboxylate (CAS 874990-36-0) is a chemical compound with the molecular formula C21H25NO2 and a molecular weight of 323.4 g/mol. IUPAC name: ethyl 1-benzyl-4-(3-methylphenyl)pyrrolidine-3-carboxylate. InChIKey: IXKMMUDJRVJIIP-UHFFFAOYSA-N.

Identity
Molecular formulaC21H25NO2
Molecular weight323.4 g/mol
IUPAC nameethyl 1-benzyl-4-(3-methylphenyl)pyrrolidine-3-carboxylate
InChIKeyIXKMMUDJRVJIIP-UHFFFAOYSA-N
SMILESCCOC(=O)C1CN(CC1C2=CC=CC(=C2)C)CC3=CC=CC=C3

Computed by PubChem (NCBI)