CAS 1024126-61-1 is the registry number for N-(6-acetylbenzo(d)1,3-dioxolan-5-yl)-2-chloropropanamide. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide (CAS 1024126-61-1) is a chemical compound with the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. IUPAC name: N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide. InChIKey: CJSBXSOARSEWRK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO4 |
|---|---|
| Molecular weight | 269.68 g/mol |
| IUPAC name | N-(6-acetyl-1,3-benzodioxol-5-yl)-2-chloropropanamide |
| InChIKey | CJSBXSOARSEWRK-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=C(C=C1C(=O)C)OCO2)Cl |
Computed by PubChem (NCBI)