CAS 1221724-63-5 appears in our catalog under these names: 3-{(2-(2-chlorophenyl)-2-oxoethyl)carbamoyl}propanoic acid, 95%, 3-{(2-(2-Chlorophenyl)-2-oxoethyl)carbamoyl}propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
4-[[2-(2-chlorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid (CAS 1221724-63-5) is a chemical compound with the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. IUPAC name: 4-[[2-(2-chlorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid. InChIKey: SIGFFHXHUVOAPQ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO4 |
|---|---|
| Molecular weight | 269.68 g/mol |
| IUPAC name | 4-[[2-(2-chlorophenyl)-2-oxoethyl]amino]-4-oxobutanoic acid |
| InChIKey | SIGFFHXHUVOAPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CNC(=O)CCC(=O)O)Cl |
Computed by PubChem (NCBI)