Products 1174985-78-4
CAS 1174985-78-4 is the registry number for 4-(6-Chloropyridin-3-yl)-3-methyl-2,4-dioxobutyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-(6-chloro-3-pyridinyl)-3-methyl-2,4-dioxobutyl] acetate (CAS 1174985-78-4) is a chemical compound with the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. IUPAC name: [4-(6-chloro-3-pyridinyl)-3-methyl-2,4-dioxobutyl] acetate. InChIKey: MDNKIUGGFOXMPL-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO4 |
|---|---|
| Molecular weight | 269.68 g/mol |
| IUPAC name | [4-(6-chloro-3-pyridinyl)-3-methyl-2,4-dioxobutyl] acetate |
| InChIKey | MDNKIUGGFOXMPL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)COC(=O)C)C(=O)C1=CN=C(C=C1)Cl |
Computed by PubChem (NCBI)