Products 63674-98-6

CAS 63674-98-6 is the registry number for 1-(3-Chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (CAS 63674-98-6) is a chemical compound with the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. IUPAC name: 1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: ZCPWASRXJNDMDW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClNO4
Molecular weight269.68 g/mol
IUPAC name1-(3-chloro-4-methoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyZCPWASRXJNDMDW-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)N2CC(CC2=O)C(=O)O)Cl

Computed by PubChem (NCBI)