Products 1024146-89-1
CAS 1024146-89-1 is the registry number for 2-(((4,6-dimethylpyrimidin-2-yl)amino)methylene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(E)-(4,6-dimethylpyrimidin-2-yl)iminomethyl]-3-hydroxyinden-1-one (CAS 1024146-89-1) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: 2-[(E)-(4,6-dimethylpyrimidin-2-yl)iminomethyl]-3-hydroxyinden-1-one. InChIKey: NPHOMPYARMLAKM-CAOOACKPSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 2-[(E)-(4,6-dimethylpyrimidin-2-yl)iminomethyl]-3-hydroxyinden-1-one |
| InChIKey | NPHOMPYARMLAKM-CAOOACKPSA-N |
| SMILES | CC1=CC(=NC(=N1)/N=C/C2=C(C3=CC=CC=C3C2=O)O)C |
Computed by PubChem (NCBI)