CAS 1253528-04-9 is the registry number for Methyl 4-(5-(pyridin-4-yl)-1H-imidazol-4-yl)benzoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(5-pyridin-4-yl-1H-imidazol-4-yl)benzoate (CAS 1253528-04-9) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: methyl 4-(5-pyridin-4-yl-1H-imidazol-4-yl)benzoate. InChIKey: UEVHYXAWYORMTH-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | methyl 4-(5-pyridin-4-yl-1H-imidazol-4-yl)benzoate |
| InChIKey | UEVHYXAWYORMTH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(NC=N2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)