CAS 1577187-24-6 is the registry number for Methyl 3-(4-phenyl-1H-1,2,3-triazol-1-yl)benzoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
Methyl 3-(4-phenyltriazol-1-yl)benzoate (CAS 1577187-24-6) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: methyl 3-(4-phenyltriazol-1-yl)benzoate. InChIKey: ZMVNUBPBCUFKMA-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | methyl 3-(4-phenyltriazol-1-yl)benzoate |
| InChIKey | ZMVNUBPBCUFKMA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N2C=C(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)