CAS 329717-75-1 is the registry number for 3-(2-(4-Methylphenyl)-2-oxoethyl)pyrido(2,3-b)pyrazin-2(1H)-one. Offered by: TRC. Available pack sizes: 1g.
3-[2-(4-methylphenyl)-2-oxoethyl]-1H-pyrido[2,3-b]pyrazin-2-one (CAS 329717-75-1) is a chemical compound with the molecular formula C16H13N3O2 and a molecular weight of 279.29 g/mol. IUPAC name: 3-[2-(4-methylphenyl)-2-oxoethyl]-1H-pyrido[2,3-b]pyrazin-2-one. InChIKey: ZBRBYUQKORENAD-UHFFFAOYSA-N.
| Molecular formula | C16H13N3O2 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 3-[2-(4-methylphenyl)-2-oxoethyl]-1H-pyrido[2,3-b]pyrazin-2-one |
| InChIKey | ZBRBYUQKORENAD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC2=NC3=C(C=CC=N3)NC2=O |
Computed by PubChem (NCBI)