Products 10242-00-9
CAS 10242-00-9 appears in our catalog under these names: 6–Nitro–1H–indole–2–carboxylic acid, 6-Nitro-1H-indole-2-carboxylic acid, 6-Nitro-1H-indole-2-carboxylic acid 95%, 6-NITRO-1H-INDOLE-2-CARBOXYLIC ACID, 95%, 95%, 6-Nitro-1H-indole-2-carboxylic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g, 10g, 25g.
6-nitro-1H-indole-2-carboxylic acid (CAS 10242-00-9) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 6-nitro-1H-indole-2-carboxylic acid. InChIKey: JIXJNWVLWQQNDB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 6-nitro-1H-indole-2-carboxylic acid |
| InChIKey | JIXJNWVLWQQNDB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC(=C2)C(=O)O |
Computed by PubChem (NCBI)