CAS 10242-12-3 appears in our catalog under these names: 5–Nitrobenzofuran–2–carboxylic acid, 5-Nitrobenzofuran-2-carboxylic Acid, >98.0%(GC)(T), 5-Nitrobenzofuran-2-carboxylic acid 98%, 5-Nitrobenzofuran-2-carboxylic acid, 98%, 5-Nitrobenzofuran-2-Carboxylic Acid, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 10g, 1 g, 5 g.
5-nitro-1-benzofuran-2-carboxylic acid (CAS 10242-12-3) is a chemical compound with the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. IUPAC name: 5-nitro-1-benzofuran-2-carboxylic acid. InChIKey: LZKWLHXJPIKJSJ-UHFFFAOYSA-N.
| Molecular formula | C9H5NO5 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 5-nitro-1-benzofuran-2-carboxylic acid |
| InChIKey | LZKWLHXJPIKJSJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=C(O2)C(=O)O |
Computed by PubChem (NCBI)