CAS 64209-68-3 appears in our catalog under these names: 6–Nitrobenzofuran–2–carboxylic acid, 6-Nitrobenzofuran-2-carboxylic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
6-nitro-1-benzofuran-2-carboxylic acid (CAS 64209-68-3) is a chemical compound with the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. IUPAC name: 6-nitro-1-benzofuran-2-carboxylic acid. InChIKey: KROYLRGNLSKXHM-UHFFFAOYSA-N.
| Molecular formula | C9H5NO5 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 6-nitro-1-benzofuran-2-carboxylic acid |
| InChIKey | KROYLRGNLSKXHM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])OC(=C2)C(=O)O |
Computed by PubChem (NCBI)