Products 167902-99-0

CAS 167902-99-0 is the registry number for 2,4-Dioxo-2,4-dihydro-1h-benzo[d][1,3]oxazine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dioxo-1H-3,1-benzoxazine-8-carboxylic acid (CAS 167902-99-0) is a chemical compound with the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. IUPAC name: 2,4-dioxo-1H-3,1-benzoxazine-8-carboxylic acid. InChIKey: HVIZTWSCWFPXES-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5NO5
Molecular weight207.14 g/mol
IUPAC name2,4-dioxo-1H-3,1-benzoxazine-8-carboxylic acid
InChIKeyHVIZTWSCWFPXES-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)C(=O)O)NC(=O)OC2=O

Computed by PubChem (NCBI)