CAS 77423-13-3 appears in our catalog under these names: 2,4-Dioxo-2,4-dihydro-1H-benzo[d][1,3]oxazine-6-carboxylic acid 95%, 2,4-Dioxo-2,4-dihydro-1H-benzo[d][1,3]oxazine-6-carboxylic acid, 95%, 95%, 2,4-Dioxo-2,4-dihydro-1H-benzo[d][1,3]oxazine-6-carboxylic acid, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dioxo-1H-3,1-benzoxazine-6-carboxylic acid (CAS 77423-13-3) is a chemical compound with the molecular formula C9H5NO5 and a molecular weight of 207.14 g/mol. IUPAC name: 2,4-dioxo-1H-3,1-benzoxazine-6-carboxylic acid. InChIKey: RTAAAHDNZMQESJ-UHFFFAOYSA-N.
| Molecular formula | C9H5NO5 |
|---|---|
| Molecular weight | 207.14 g/mol |
| IUPAC name | 2,4-dioxo-1H-3,1-benzoxazine-6-carboxylic acid |
| InChIKey | RTAAAHDNZMQESJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)