Products 1024270-93-6
CAS 1024270-93-6 is the registry number for 2,6-dimethyl-1-(4-(isopropyl)phenyl)-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
2,6-dimethyl-1-(4-propan-2-ylphenyl)-6,7-dihydro-5H-indol-4-one (CAS 1024270-93-6) is a chemical compound with the molecular formula C19H23NO and a molecular weight of 281.4 g/mol. IUPAC name: 2,6-dimethyl-1-(4-propan-2-ylphenyl)-6,7-dihydro-5H-indol-4-one. InChIKey: GIVUPPANHSMATO-UHFFFAOYSA-N.
| Molecular formula | C19H23NO |
|---|---|
| Molecular weight | 281.4 g/mol |
| IUPAC name | 2,6-dimethyl-1-(4-propan-2-ylphenyl)-6,7-dihydro-5H-indol-4-one |
| InChIKey | GIVUPPANHSMATO-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CC=C(C=C3)C(C)C)C)C(=O)C1 |
Computed by PubChem (NCBI)