Products 102438-62-0
CAS 102438-62-0 appears in our catalog under these names: Bisphenol A-2,2',6,6'-d4, >95% (HPLC), Bisphenol A-2,2',6,6'-d4, 98 atom % D, min 98% Chemical Purity, Bisphenol A–d4, Bisphenol A-d4. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 5mg, 5 mg, 10 mg.
3,5-dideuterio-4-[2-(2,6-dideuterio-4-hydroxyphenyl)propan-2-yl]phenol (CAS 102438-62-0) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 232.31 g/mol. IUPAC name: 3,5-dideuterio-4-[2-(2,6-dideuterio-4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: IISBACLAFKSPIT-LNFUJOGGSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 232.31 g/mol |
| IUPAC name | 3,5-dideuterio-4-[2-(2,6-dideuterio-4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | IISBACLAFKSPIT-LNFUJOGGSA-N |
| SMILES | [2H]C1=CC(=CC(=C1C(C)(C)C2=C(C=C(C=C2[2H])O)[2H])[2H])O |
Computed by PubChem (NCBI)