CAS 92739-58-7 appears in our catalog under these names: Bisphenol A-d8, >95% (HPLC), Bisphenol A-2,2',3,3',5,5',6,6'-d8, 98 atom % D, min 98% Chemical Purity, BisPhenol A-d8, Bisphenol A-d8, 99.26%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 0,1g, 0,05g, 5mg, 50mg, 10 mg.
2,3,5,6-tetradeuterio-4-[2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol (CAS 92739-58-7) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 236.33 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: IISBACLAFKSPIT-UWAUJQNOSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 236.33 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | IISBACLAFKSPIT-UWAUJQNOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C)(C)C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)