Products 263261-64-9
CAS 263261-64-9 appears in our catalog under these names: Bisphenol A-13C2, >95% (HPLC), Bisphenol A-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 10 mg, 1 mg, 5 mg.
4-[2-(4-hydroxyphenyl)(1,3-13C2)propan-2-yl]phenol (CAS 263261-64-9) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 230.27 g/mol. IUPAC name: 4-[2-(4-hydroxyphenyl)(1,3-13C2)propan-2-yl]phenol. InChIKey: IISBACLAFKSPIT-ZDOIIHCHSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 230.27 g/mol |
| IUPAC name | 4-[2-(4-hydroxyphenyl)(1,3-13C2)propan-2-yl]phenol |
| InChIKey | IISBACLAFKSPIT-ZDOIIHCHSA-N |
| SMILES | [13CH3]C([13CH3])(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)