CAS 120155-79-5 appears in our catalog under these names: Bisphenol A–d14, Bisphenol A-d14, >95% (HPLC), Bisphenol A D14 100 µg/mL in Acetonitrile, Bisphenol A d14, Bisphenol A-d14, 99.74%. Offered by: GLPBio, TRC, Dr. Ehrenstorfer, Biosynth, MedChemExpress. Available pack sizes: 5mg, 100mg, 10mg, 50mg, 1ml, 1mg, 500mg, 250mg.
2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol (CAS 120155-79-5) is a chemical compound with the molecular formula C15H16O2 and a molecular weight of 242.37 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: IISBACLAFKSPIT-DDAUHAMOSA-N.
| Molecular formula | C15H16O2 |
|---|---|
| Molecular weight | 242.37 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | IISBACLAFKSPIT-DDAUHAMOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(C2=C(C(=C(C(=C2[2H])[2H])O)[2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)