Products 102438-99-3
CAS 102438-99-3 appears in our catalog under these names: 2,4,6-Trimethoxyaniline hydrochloride, 2,4,6-Trimethoxyaniline hydrochloride, 95%, 2,4,6-Trimethoxyaniline hydrochloride, 98%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 25g, 10g.
2,4,6-trimethoxyaniline;hydrochloride (CAS 102438-99-3) is a chemical compound with the molecular formula C9H14ClNO3 and a molecular weight of 219.66 g/mol. IUPAC name: 2,4,6-trimethoxyaniline;hydrochloride. InChIKey: GRHAUEFIQOUKAY-UHFFFAOYSA-N.
| Molecular formula | C9H14ClNO3 |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | 2,4,6-trimethoxyaniline;hydrochloride |
| InChIKey | GRHAUEFIQOUKAY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)N)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4,6-trimethoxyaniline Hydrochloride, 2,4,6-trimethoxyaniline;hydrochloride, 2,4,6-Trimethoxyaniline (hydrochloride), GRHAUEFIQOUKAY-UHFFFAOYSA-N, 2,4,6-trimethoxyphenylamine, chloride, 2,4,6 trimethoxy aniline mono HCl salt, Benzenamine,2,4,6-trimethoxy-, hydrochloride, 2,4,6-Trimethoxyaniline--hydrogen chloride (1/1)