CAS 1024431-85-3 is the registry number for methyl 2-(3-nitrilo-4-nitrophenylthio)acetate. Offered by: Biosynth. Available pack sizes: 250mg.
Methyl 2-(3-cyano-4-nitrophenyl)sulfanylacetate (CAS 1024431-85-3) is a chemical compound with the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. IUPAC name: methyl 2-(3-cyano-4-nitrophenyl)sulfanylacetate. InChIKey: WJPWMSHFINQTAN-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4S |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | methyl 2-(3-cyano-4-nitrophenyl)sulfanylacetate |
| InChIKey | WJPWMSHFINQTAN-UHFFFAOYSA-N |
| SMILES | COC(=O)CSC1=CC(=C(C=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)