CAS 91445-62-4 is the registry number for 1,1-Dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid (CAS 91445-62-4) is a chemical compound with the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. IUPAC name: 1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid. InChIKey: MHCNCENFUHVWGH-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4S |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | 1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid |
| InChIKey | MHCNCENFUHVWGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NS(=O)(=O)NC(=C2)C(=O)O |
Computed by PubChem (NCBI)