Products 91445-62-4

CAS 91445-62-4 is the registry number for 1,1-Dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid (CAS 91445-62-4) is a chemical compound with the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. IUPAC name: 1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid. InChIKey: MHCNCENFUHVWGH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8N2O4S
Molecular weight252.25 g/mol
IUPAC name1,1-dioxo-5-phenyl-2H-1,2,6-thiadiazine-3-carboxylic acid
InChIKeyMHCNCENFUHVWGH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NS(=O)(=O)NC(=C2)C(=O)O

Computed by PubChem (NCBI)