Products 879189-83-0
CAS 879189-83-0 is the registry number for 1-Methyl-3-(2-oxo-2-(thiophen-2-yl)ethyl)imidazolidine-2,4,5-trione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione (CAS 879189-83-0) is a chemical compound with the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. IUPAC name: 1-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione. InChIKey: RORWTTKRWXIHGJ-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4S |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | 1-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4,5-trione |
| InChIKey | RORWTTKRWXIHGJ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=O)N(C1=O)CC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)