Products 17796-89-3
CAS 17796-89-3 is the registry number for 1-((4-Nitrophenyl)sulfanyl)pyrrolidine-2,5-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(4-nitrophenyl)sulfanylpyrrolidine-2,5-dione (CAS 17796-89-3) is a chemical compound with the molecular formula C10H8N2O4S and a molecular weight of 252.25 g/mol. IUPAC name: 1-(4-nitrophenyl)sulfanylpyrrolidine-2,5-dione. InChIKey: OFMYIQWJIWBLCY-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4S |
|---|---|
| Molecular weight | 252.25 g/mol |
| IUPAC name | 1-(4-nitrophenyl)sulfanylpyrrolidine-2,5-dione |
| InChIKey | OFMYIQWJIWBLCY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)SC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)