Products 10245-01-9
CAS 10245-01-9 is the registry number for 2,3',4-Trimethylbiphenyl. Offered by: TRC. Available pack sizes: 250mg.
2,4-dimethyl-1-(3-methylphenyl)benzene (CAS 10245-01-9) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 2,4-dimethyl-1-(3-methylphenyl)benzene. InChIKey: YEXVBRNCTPOJMO-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 2,4-dimethyl-1-(3-methylphenyl)benzene |
| InChIKey | YEXVBRNCTPOJMO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=C(C=C(C=C2)C)C |
Computed by PubChem (NCBI)