CAS 10245-44-0 is the registry number for TJU103. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[(E)-1H-indol-3-ylmethylideneamino]pyridine-4-carboxamide (CAS 10245-44-0) is a chemical compound with the molecular formula C15H12N4O and a molecular weight of 264.28 g/mol. IUPAC name: N-[(E)-1H-indol-3-ylmethylideneamino]pyridine-4-carboxamide. InChIKey: YRXIZOPHHNNLIT-VCHYOVAHSA-N.
| Molecular formula | C15H12N4O |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | N-[(E)-1H-indol-3-ylmethylideneamino]pyridine-4-carboxamide |
| InChIKey | YRXIZOPHHNNLIT-VCHYOVAHSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=N/NC(=O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)