CAS 5109-97-7 appears in our catalog under these names: 2-Pyridin-3-yl-quinoline-4-carboxylic acid hydrazide, 95%, 2-(Pyridin-3-yl)quinoline-4-carbohydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-pyridin-3-ylquinoline-4-carbohydrazide (CAS 5109-97-7) is a chemical compound with the molecular formula C15H12N4O and a molecular weight of 264.28 g/mol. IUPAC name: 2-pyridin-3-ylquinoline-4-carbohydrazide. InChIKey: ZENFAFLFPWVDNO-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-pyridin-3-ylquinoline-4-carbohydrazide |
| InChIKey | ZENFAFLFPWVDNO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=N2)C3=CN=CC=C3)C(=O)NN |
Computed by PubChem (NCBI)