Products 1061160-22-2
CAS 1061160-22-2 is the registry number for Nevirapine quinone methide. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-cyclopropyl-7-methylidene-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,8,12,14-hexaen-10-one (CAS 1061160-22-2) is a chemical compound with the molecular formula C15H12N4O and a molecular weight of 264.28 g/mol. IUPAC name: 2-cyclopropyl-7-methylidene-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,8,12,14-hexaen-10-one. InChIKey: OBSDFAOEJNYEFX-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 2-cyclopropyl-7-methylidene-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,8,12,14-hexaen-10-one |
| InChIKey | OBSDFAOEJNYEFX-UHFFFAOYSA-N |
| SMILES | C=C1C=CN=C2C1=NC(=O)C3=C(N2C4CC4)N=CC=C3 |
Computed by PubChem (NCBI)