Products 882231-15-4
CAS 882231-15-4 is the registry number for 1-Phenyl-3-(pyridin-3-yl)-1H-pyrazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide (CAS 882231-15-4) is a chemical compound with the molecular formula C15H12N4O and a molecular weight of 264.28 g/mol. IUPAC name: 1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide. InChIKey: JNJAZTHCXKECKP-UHFFFAOYSA-N.
| Molecular formula | C15H12N4O |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 1-phenyl-3-pyridin-3-ylpyrazole-4-carboxamide |
| InChIKey | JNJAZTHCXKECKP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CN=CC=C3)C(=O)N |
Computed by PubChem (NCBI)