CAS 1024571-10-5 is the registry number for 3-(4-bromophenyl)-7-methyl-6,7,8-trihydrocinnolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-bromophenyl)-7-methyl-7,8-dihydro-6H-cinnolin-5-one (CAS 1024571-10-5) is a chemical compound with the molecular formula C15H13BrN2O and a molecular weight of 317.18 g/mol. IUPAC name: 3-(4-bromophenyl)-7-methyl-7,8-dihydro-6H-cinnolin-5-one. InChIKey: YECDWQJYOAIDMX-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2O |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 3-(4-bromophenyl)-7-methyl-7,8-dihydro-6H-cinnolin-5-one |
| InChIKey | YECDWQJYOAIDMX-UHFFFAOYSA-N |
| SMILES | CC1CC2=NN=C(C=C2C(=O)C1)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)