Products 374545-17-2
CAS 374545-17-2 is the registry number for 2-(3-Bromo-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine (CAS 374545-17-2) is a chemical compound with the molecular formula C15H13BrN2O and a molecular weight of 317.18 g/mol. IUPAC name: 2-(3-bromo-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine. InChIKey: QNSRUONBZCCONU-UHFFFAOYSA-N.
| Molecular formula | C15H13BrN2O |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | 2-(3-bromo-4-methoxyphenyl)-7-methylimidazo[1,2-a]pyridine |
| InChIKey | QNSRUONBZCCONU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CN2C=C1)C3=CC(=C(C=C3)OC)Br |
Computed by PubChem (NCBI)